EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H15NO3 |
| Net Charge | 0 |
| Average Mass | 185.223 |
| Monoisotopic Mass | 185.10519 |
| SMILES | NC(CC1C=CC(O)CC1)C(=O)O |
| InChI | InChI=1S/C9H15NO3/c10-8(9(12)13)5-6-1-3-7(11)4-2-6/h1,3,6-8,11H,2,4-5,10H2,(H,12,13) |
| InChIKey | IDAZNKKJQCQDMT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tetrahydrotyrosine (CHEBI:64807) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| tetrahydrotyrosine (CHEBI:64807) is a secondary alcohol (CHEBI:35681) |
| tetrahydrotyrosine (CHEBI:64807) is tautomer of tetrahydrotyrosine zwitterion (CHEBI:64791) |
| Incoming Relation(s) |
| tetrahydrotyrosine zwitterion (CHEBI:64791) is tautomer of tetrahydrotyrosine (CHEBI:64807) |
| IUPAC Name |
|---|
| 3-(4-hydroxycyclohex-2-en-1-yl)alanine |
| Synonym | Source |
|---|---|
| 4,7,8,9-tetrahydrotyrosine | ChEBI |
| Citations |
|---|