EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | [H][C@@]12CC[C@@]3([H])C(=C)[C@]1(C)CC[C@H](C(C)C)[C@@]23[H] |
| InChI | InChI=1S/C15H24/c1-9(2)11-7-8-15(4)10(3)12-5-6-13(15)14(11)12/h9,11-14H,3,5-8H2,1-2,4H3/t11-,12+,13+,14-,15+/m1/s1 |
| InChIKey | VOBBUADSYROGAT-FQKPHLNHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Helminthosporium sativum (fungorum:172191) | - | PubMed (14324316) |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-sativene (CHEBI:64800) has role fungal metabolite (CHEBI:76946) |
| (−)-sativene (CHEBI:64800) is a bridged compound (CHEBI:35990) |
| (−)-sativene (CHEBI:64800) is a sesquiterpene (CHEBI:35189) |
| IUPAC Name |
|---|
| (1R,3aS,4R,7R,7aR)-4-methyl-8-methylidene-7-(propan-2-yl)octahydro-1H-1,4-methanoindene |
| Synonyms | Source |
|---|---|
| sativene | ChEBI |
| (1R,3aS,4R,7R,7aR)-7-isopropyl-4-methyl-8-methyleneoctahydro-1H-1,4-methanoindene | IUPAC |
| UniProt Name | Source |
|---|---|
| (−)-sativene | UniProt |
| Citations |
|---|