EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C38H63O6P |
| Net Charge | -2 |
| Average Mass | 646.890 |
| Monoisotopic Mass | 646.43732 |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/COC[C@H](O)COP(=O)([O-])[O-] |
| InChI | InChI=1S/C38H65O6P/c1-31(2)15-9-16-32(3)17-10-18-33(4)19-11-20-34(5)21-12-22-35(6)23-13-24-36(7)25-14-26-37(8)27-28-43-29-38(39)30-44-45(40,41)42/h15,17,19,21,23,25,27,38-39H,9-14,16,18,20,22,24,26,28-30H2,1-8H3,(H2,40,41,42)/p-2/b32-17+,33-19+,34-21+,35-23+,36-25+,37-27+/t38-/m0/s1 |
| InChIKey | CVJYKALOCTYTRR-HNNRUBMXSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-heptaprenyl-sn-glycero-1-phosphate(2−) (CHEBI:64781) is a anionic phospholipid (CHEBI:62643) |
| 3-heptaprenyl-sn-glycero-1-phosphate(2−) (CHEBI:64781) is conjugate base of 3-heptaprenyl-sn-glycero-1-phosphate (CHEBI:64937) |
| Incoming Relation(s) |
| 3-heptaprenyl-sn-glycero-1-phosphate (CHEBI:64937) is conjugate acid of 3-heptaprenyl-sn-glycero-1-phosphate(2−) (CHEBI:64781) |
| IUPAC Name |
|---|
| (2S)-3-{[(2E,6E,10E,14E,18E,22E)-3,7,11,15,19,23,27-heptamethyloctacosa-2,6,10,14,18,22,26-heptaen-1-yl]oxy}-2-hydroxypropyl phosphate |
| Synonyms | Source |
|---|---|
| heptaprenylglycerophosphate | ChEBI |
| heptaprenylglycerophosphate(1−) | ChEBI |
| heptaprenylglyceryl phosphate | ChEBI |
| heptaprenylglyceryl phosphate(2−) | ChEBI |
| 1-heptaprenyl-glycero-3-phosphate | ChEBI |
| 3-heptaprenyl-sn-glycero-1-phosphate | ChEBI |
| UniProt Name | Source |
|---|---|
| 3-heptaprenyl-sn-glycero-1-phosphate | UniProt |
| Citations |
|---|