EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H42O |
| Net Charge | 0 |
| Average Mass | 394.643 |
| Monoisotopic Mass | 394.32357 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)/C=C/[C@H](C)C(C)C)[C@@]1(C)CC=C1C2=CC=C2C[C@@H](O)CC[C@@]21C |
| InChI | InChI=1S/C28H42O/c1-18(2)19(3)7-8-20(4)24-11-12-25-23-10-9-21-17-22(29)13-15-27(21,5)26(23)14-16-28(24,25)6/h7-10,14,18-20,22,24-25,29H,11-13,15-17H2,1-6H3/b8-7+/t19-,20+,22-,24+,25-,27-,28+/m0/s1 |
| InChIKey | QSVJYFLQYMVBDR-CMNOFMQQSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | biomarker A substance used as an indicator of a biological state. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dehydroergosterol (CHEBI:64762) has role biomarker (CHEBI:59163) |
| dehydroergosterol (CHEBI:64762) has role metabolite (CHEBI:25212) |
| dehydroergosterol (CHEBI:64762) is a 3β-hydroxy-Δ5-steroid (CHEBI:1722) |
| dehydroergosterol (CHEBI:64762) is a 3β-sterol (CHEBI:35348) |
| dehydroergosterol (CHEBI:64762) is a ergostanoid (CHEBI:50403) |
| dehydroergosterol (CHEBI:64762) is a phytosterols (CHEBI:26125) |
| IUPAC Name |
|---|
| (22E)-ergosta-5,7,9(11),22-tetraen-3β-ol |
| Synonyms | Source |
|---|---|
| (3β,22E)-ergosta-5,7,9(11),22-tetraen-3-ol | IUPAC |
| delta(5,7,9(11)22)-Ergostatetraen-3-ol | ChemIDplus |
| Ergosta-5,7,9(11),22-tetraen-3beta-ol | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| LMST01031023 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3218613 | Reaxys |
| CAS:516-85-8 | ChemIDplus |
| Citations |
|---|