EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | Mg.2NO3 |
| Net Charge | 0 |
| Average Mass | 148.313 |
| Monoisotopic Mass | 147.96068 |
| SMILES | O=[N+]([O-])[O-].O=[N+]([O-])[O-].[Mg+2] |
| InChI | InChI=1S/Mg.2NO3/c;2*2-1(3)4/q+2;2*-1 |
| InChIKey | YIXJRHPUWRPCBB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | fertilizer A fertilizer is any substance that is added to soil or water to assist the growth of plants. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| magnesium nitrate (CHEBI:64736) has role fertilizer (CHEBI:33287) |
| magnesium nitrate (CHEBI:64736) is a inorganic nitrate salt (CHEBI:51084) |
| magnesium nitrate (CHEBI:64736) is a magnesium salt (CHEBI:33975) |
| IUPAC Name |
|---|
| magnesium dinitrate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:16055468 | Reaxys |
| CAS:10377-60-3 | ChemIDplus |
| Citations |
|---|