EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H12OS |
| Net Charge | 0 |
| Average Mass | 216.305 |
| Monoisotopic Mass | 216.06089 |
| SMILES | CCc1ccc(C(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C13H12OS/c1-2-10-5-7-11(8-6-10)13(14)12-4-3-9-15-12/h3-9H,2H2,1H3 |
| InChIKey | GODQIIKZEJTEPS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| decarboxysuprofen (CHEBI:64707) has role epitope (CHEBI:53000) |
| decarboxysuprofen (CHEBI:64707) is a aromatic ketone (CHEBI:76224) |
| decarboxysuprofen (CHEBI:64707) is a thiophenes (CHEBI:26961) |
| IUPAC Name |
|---|
| (4-ethylphenyl)(2-thienyl)methanone |
| Synonyms | Source |
|---|---|
| 4-Ethylphenyl 2-thienyl ketone | ChemIDplus |
| p-ethylphenyl 2-thienyl ketone | ChEBI |
| 2-(p-ethylbenzoyl)thiophene | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1638931 | Reaxys |
| CAS:52779-81-4 | ChemIDplus |
| Citations |
|---|