EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H12OS |
| Net Charge | 0 |
| Average Mass | 216.305 |
| Monoisotopic Mass | 216.06089 |
| SMILES | CCc1ccc(C(=O)c2ccccc2)s1 |
| InChI | InChI=1S/C13H12OS/c1-2-11-8-9-12(15-11)13(14)10-6-4-3-5-7-10/h3-9H,2H2,1H3 |
| InChIKey | KRUFIFKRFHMKHL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. |
| Application: | photosensitizing agent A chemical compound that can be excited by light of a specific wavelength and subsequently transfer energy to a chosen reactant. This is commonly molecular oxygen within a cancer tissue, which is converted to (highly rective) singlet state oxygen. This rapidly reacts with any nearby biomolecules, ultimately killing the cancer cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| decarboxytiaprofenic acid (CHEBI:64706) has role epitope (CHEBI:53000) |
| decarboxytiaprofenic acid (CHEBI:64706) has role photosensitizing agent (CHEBI:47868) |
| decarboxytiaprofenic acid (CHEBI:64706) is a aromatic ketone (CHEBI:76224) |
| decarboxytiaprofenic acid (CHEBI:64706) is a thiophenes (CHEBI:26961) |
| IUPAC Name |
|---|
| (5-ethyl-2-thienyl)(phenyl)methanone |
| Synonym | Source |
|---|---|
| 5-ethyl-2-benzoylthiophene | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:151561 | Reaxys |
| Citations |
|---|