EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H23NO4 |
| Net Charge | 0 |
| Average Mass | 329.396 |
| Monoisotopic Mass | 329.16271 |
| SMILES | CC[C@H](C)C[C@H](C)C(=O)c1c(O)c(-c2ccc(O)cc2)cnc1=O |
| InChI | InChI=1S/C19H23NO4/c1-4-11(2)9-12(3)17(22)16-18(23)15(10-20-19(16)24)13-5-7-14(21)8-6-13/h5-8,10-12,21H,4,9H2,1-3H3,(H2,20,23,24)/t11-,12-/m0/s1 |
| InChIKey | LIBKJCZUBOETPB-RYUDHWBXSA-N |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aspyridone A (CHEBI:64704) has role fungal metabolite (CHEBI:76946) |
| aspyridone A (CHEBI:64704) is a polyketide (CHEBI:26188) |
| aspyridone A (CHEBI:64704) is a pyridone (CHEBI:38183) |
| IUPAC Name |
|---|
| 3-[(2S,4S)-2,4-dimethylhexanoyl]-4-hydroxy-5-(4-hydroxyphenyl)pyridin-2(1H)-one |
| Citations |
|---|