EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H10O4 |
| Net Charge | 0 |
| Average Mass | 218.208 |
| Monoisotopic Mass | 218.05791 |
| SMILES | [H]C(=CC(=O)C(=O)O)CC(=O)c1ccccc1 |
| InChI | InChI=1S/C12H10O4/c13-10(9-5-2-1-3-6-9)7-4-8-11(14)12(15)16/h1-6,8H,7H2,(H,15,16) |
| InChIKey | QPGAZPBFRAAJBD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,6-dioxo-6-phenylhexa-3-enoic acid (CHEBI:64687) is a aromatic ketone (CHEBI:76224) |
| 2,6-dioxo-6-phenylhexa-3-enoic acid (CHEBI:64687) is a dioxo monocarboxylic acid (CHEBI:35951) |
| 2,6-dioxo-6-phenylhexa-3-enoic acid (CHEBI:64687) is a enone (CHEBI:51689) |
| 2,6-dioxo-6-phenylhexa-3-enoic acid (CHEBI:64687) is conjugate acid of 2,6-dioxo-6-phenylhexa-3-enoate (CHEBI:64675) |
| 2,6-dioxo-6-phenylhexa-3-enoic acid (CHEBI:64687) is tautomer of 2-hydroxy-6-oxo-6-phenylhexa-2,4-dienoic acid (CHEBI:17820) |
| Incoming Relation(s) |
| 2,6-dioxo-6-phenylhexa-3-enoate (CHEBI:64675) is conjugate base of 2,6-dioxo-6-phenylhexa-3-enoic acid (CHEBI:64687) |
| 2-hydroxy-6-oxo-6-phenylhexa-2,4-dienoic acid (CHEBI:17820) is tautomer of 2,6-dioxo-6-phenylhexa-3-enoic acid (CHEBI:64687) |
| IUPAC Name |
|---|
| 2,6-dioxo-6-phenylhexa-3-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| CPD-613 | MetaCyc |