EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H59N3O9 |
| Net Charge | 0 |
| Average Mass | 653.858 |
| Monoisotopic Mass | 653.42513 |
| SMILES | CC(C)C[C@H]1C(=O)O[C@H](C(C)C)C(=O)N(C)[C@@H](C(C)C)C(=O)O[C@H](C(C)C)C(=O)N(C)[C@@H](C(C)C)C(=O)O[C@H](C(C)C)C(=O)N1C |
| InChI | InChI=1S/C34H59N3O9/c1-17(2)16-23-32(41)44-27(21(9)10)30(39)36(14)25(19(5)6)34(43)46-28(22(11)12)31(40)37(15)24(18(3)4)33(42)45-26(20(7)8)29(38)35(23)13/h17-28H,16H2,1-15H3/t23-,24-,25-,26+,27+,28+/m0/s1 |
| InChIKey | PKDCQKBQAKLZBD-SCUYQTRWSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. mycotoxin Poisonous substance produced by fungi. ionophore A compound which can carry specific ions through membranes of cells or organelles. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| enniatin B4 (CHEBI:64650) is a enniatin (CHEBI:64648) |
| IUPAC Name |
|---|
| (3S,6R,9S,12R,15S,18R)-3-isobutyl-6,9,12,15,18-pentaisopropyl-4,10,16-trimethyl-1,7,13-trioxa-4,10,16-triazacyclooctadecane-2,5,8,11,14,17-hexone |
| Synonyms | Source |
|---|---|
| enniatin D | SUBMITTER |
| Enniatin D | KEGG COMPOUND |
| Citations |
|---|