EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H4N2O3S |
| Net Charge | -1 |
| Average Mass | 184.176 |
| Monoisotopic Mass | 183.99481 |
| SMILES | *N=Nc1cccc(S(=O)(=O)[O-])c1 |
| Roles Classification |
|---|
| Biological Role: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3-sulfonatophenyl)azo group (CHEBI:64636) has role allergen (CHEBI:50904) |
| (3-sulfonatophenyl)azo group (CHEBI:64636) is a organic anionic group (CHEBI:64775) |
| (3-sulfonatophenyl)azo group (CHEBI:64636) is a phenylazo groups (CHEBI:64638) |
| (3-sulfonatophenyl)azo group (CHEBI:64636) is substituent group from 3-diazoniobenzenesulfonate (CHEBI:64458) |
| IUPAC Name |
|---|
| (3-sulfonatophenyl)diazenyl |
| Synonyms | Source |
|---|---|
| m-azobenzenesulfonate | ChEBI |
| m-azobenzenesulphonate | ChEBI |
| Citations |
|---|