EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H17NO7 |
| Net Charge | 0 |
| Average Mass | 383.356 |
| Monoisotopic Mass | 383.10050 |
| SMILES | [H]C1(C)CC([H])(c2c(O)cc(O)c3c(=O)c(O)c(-c4ccc(O)cc4)oc23)NC1=O |
| InChI | InChI=1S/C20H17NO7/c1-8-6-11(21-20(8)27)14-12(23)7-13(24)15-16(25)17(26)18(28-19(14)15)9-2-4-10(22)5-3-9/h2-5,7-8,11,22-24,26H,6H2,1H3,(H,21,27) |
| InChIKey | YDCRQLJCXBNURP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lilaline (CHEBI:6461) has role plant metabolite (CHEBI:76924) |
| lilaline (CHEBI:6461) is a 7-hydroxyflavonol (CHEBI:52267) |
| lilaline (CHEBI:6461) is a pyrrolidin-2-ones (CHEBI:74223) |
| lilaline (CHEBI:6461) is a tetrahydroxyflavone (CHEBI:38684) |
| IUPAC Name |
|---|
| 3-methyl-5-[3,5,7-trihydroxy-2-(4-hydroxyphenyl)-4-oxo-4H-1-benzopyran-8-yl]pyrrolidin-2-one |