EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H21N5O4 |
| Net Charge | 0 |
| Average Mass | 443.463 |
| Monoisotopic Mass | 443.15935 |
| SMILES | [H][C@]12N[C@@H](C)C(=O)N1c1ccccc1[C@@]21C[C@@H]2C(=O)N[C@@](C)(O1)c1nc3ccccc3c(=O)n12 |
| InChI | InChI=1S/C24H21N5O4/c1-12-19(31)28-16-10-6-4-8-14(16)24(22(28)25-12)11-17-18(30)27-23(2,33-24)21-26-15-9-5-3-7-13(15)20(32)29(17)21/h3-10,12,17,22,25H,11H2,1-2H3,(H,27,30)/t12-,17+,22-,23-,24-/m0/s1 |
| InChIKey | POEYRUBMWIOMTB-LTQSKDJASA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fumiquinazoline C (CHEBI:64551) is a azaspiro compound (CHEBI:35624) |
| fumiquinazoline C (CHEBI:64551) is a fumiquinazoline (CHEBI:64545) |
| fumiquinazoline C (CHEBI:64551) is a imidazoindole (CHEBI:64547) |
| fumiquinazoline C (CHEBI:64551) is a organic heteroheptacyclic compound (CHEBI:52157) |
| fumiquinazoline C (CHEBI:64551) is a oxaspiro compound (CHEBI:37948) |
| IUPAC Name |
|---|
| (1S,2'S,3S,5R,9a'S)-1,2'-dimethyl-1',9a'-dihydro-4H-spiro[1,5-(epiminomethano)[1,4]oxazepino[3,4-b]quinazoline-3,9'-imidazo[1,2-a]indole]-3',7,13(1H,2'H,5H)-trione |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9096080 | Reaxys |
| Citations |
|---|