EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H30N2O3 |
| Net Charge | 0 |
| Average Mass | 490.603 |
| Monoisotopic Mass | 490.22564 |
| SMILES | C=CC(C)(C)c1nc2ccccc2c1C1=C(O)C(=O)C(c2cnc3ccccc23)=C(CC=C(C)C)C1=O |
| InChI | InChI=1S/C32H30N2O3/c1-6-32(4,5)31-26(20-12-8-10-14-24(20)34-31)27-28(35)21(16-15-18(2)3)25(29(36)30(27)37)22-17-33-23-13-9-7-11-19(22)23/h6-15,17,33-34,37H,1,16H2,2-5H3 |
| InChIKey | HBMHEGGZNWXZRA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| terrequinone A (CHEBI:64534) has role antineoplastic agent (CHEBI:35610) |
| terrequinone A (CHEBI:64534) is a bisindole alkaloid (CHEBI:51879) |
| terrequinone A (CHEBI:64534) is a monohydroxy-1,4-benzoquinones (CHEBI:67273) |
| IUPAC Name |
|---|
| 2-hydroxy-6-(1H-indol-3-yl)-5-(3-methylbut-2-en-1-yl)-3-[2-(2-methylbut-3-en-2-yl)-1H-indol-3-yl]-1,4-benzoquinone |
| Manual Xrefs | Databases |
|---|---|
| US2009011476 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11308811 | Reaxys |
| Citations |
|---|