EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H33N3O5 |
| Net Charge | 0 |
| Average Mass | 479.577 |
| Monoisotopic Mass | 479.24202 |
| SMILES | [H][C@@]12CCCN1C(=O)[C@]1(O)[C@@H](O)c3c(n(CC=C(C)C)c4cc(OC)ccc34)[C@]([H])(C=C(C)C)N1C2=O |
| InChI | InChI=1S/C27H33N3O5/c1-15(2)10-12-28-20-14-17(35-5)8-9-18(20)22-23(28)21(13-16(3)4)30-25(32)19-7-6-11-29(19)26(33)27(30,34)24(22)31/h8-10,13-14,19,21,24,31,34H,6-7,11-12H2,1-5H3/t19-,21-,24-,27+/m0/s1 |
| InChIKey | WEIYXEFMCIRZHC-MWGWWEMPSA-N |
| Roles Classification |
|---|
| Biological Roles: | mycotoxin Poisonous substance produced by fungi. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fumitremorgin B (CHEBI:64531) has role mycotoxin (CHEBI:25442) |
| fumitremorgin B (CHEBI:64531) is a indole alkaloid (CHEBI:38958) |
| fumitremorgin B (CHEBI:64531) is a organic heteropentacyclic compound (CHEBI:38164) |
| IUPAC Name |
|---|
| (5aR,6S,12S,14aS)-5a,6-dihydroxy-9-methoxy-11-(3-methylbut-2-en-1-yl)-12-(2-methylprop-1-en-1-yl)-1,2,3,5a,6,11,12,14a-octahydro-5H,14H-pyrrolo[1'',2'':4',5']pyrazino[1',2':1,6]pyrido[3,4-b]indole-5,14-dione |
| Synonym | Source |
|---|---|
| Lanosulin | ChemIDplus |
| UniProt Name | Source |
|---|---|
| fumitremorgin B | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:905336 | Reaxys |
| CAS:12626-17-4 | ChemIDplus |
| Citations |
|---|