EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H20O7 |
| Net Charge | 0 |
| Average Mass | 372.373 |
| Monoisotopic Mass | 372.12090 |
| SMILES | CCCCCC(O)c1c(O)cc2c(c1O)C(=O)c1c(O)cc(O)cc1C2=O |
| InChI | InChI=1S/C20H20O7/c1-2-3-4-5-12(22)17-14(24)8-11-16(20(17)27)19(26)15-10(18(11)25)6-9(21)7-13(15)23/h6-8,12,21-24,27H,2-5H2,1H3 |
| InChIKey | WGPOPPKSQRZUTP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| averantin (CHEBI:64522) has role fungal metabolite (CHEBI:76946) |
| averantin (CHEBI:64522) is a polyketide (CHEBI:26188) |
| averantin (CHEBI:64522) is a tetrahydroxyanthraquinone (CHEBI:37496) |
| Incoming Relation(s) |
| (S)-averantin (CHEBI:71534) is a averantin (CHEBI:64522) |
| IUPAC Name |
|---|
| 1,3,6,8-tetrahydroxy-2-(1-hydroxyhexyl)-9,10-anthraquinone |
| Synonyms | Source |
|---|---|
| 2-(1-Hydroxyhexyl)-1,3,6,8-tetrahydroxyanthraquinone | ChemIDplus |
| 1,3,6,8-Tetrahydroxy-2-(1-hydroxyhexyl)anthraquinone | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2309929 | Reaxys |
| CAS:5803-62-3 | ChemIDplus |
| Citations |
|---|