EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H28O5 |
| Net Charge | 0 |
| Average Mass | 408.494 |
| Monoisotopic Mass | 408.19367 |
| SMILES | CC(C)=CCOc1c(C)cc2oc3c(CC=C(C)C)ccc(O)c3c(=O)c2c1CO |
| InChI | InChI=1S/C25H28O5/c1-14(2)6-7-17-8-9-19(27)22-23(28)21-18(13-26)24(29-11-10-15(3)4)16(5)12-20(21)30-25(17)22/h6,8-10,12,26-27H,7,11,13H2,1-5H3 |
| InChIKey | JZHBEPYIKRDWBE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| emericellin (CHEBI:64512) has role metabolite (CHEBI:25212) |
| emericellin (CHEBI:64512) is a aromatic ether (CHEBI:35618) |
| emericellin (CHEBI:64512) is a phenols (CHEBI:33853) |
| emericellin (CHEBI:64512) is a xanthones (CHEBI:51149) |
| IUPAC Name |
|---|
| 8-hydroxy-1-(hydroxymethyl)-3-methyl-5-(3-methylbut-2-en-1-yl)-2-[(3-methylbut-2-en-1-yl)oxy]-9H-xanthen-9-one |
| Synonym | Source |
|---|---|
| Variecoxanthone B | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1693449 | Reaxys |
| CAS:55812-93-6 | ChemIDplus |
| Citations |
|---|