EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H26O5 |
| Net Charge | 0 |
| Average Mass | 406.478 |
| Monoisotopic Mass | 406.17802 |
| SMILES | C=C(C)[C@H]1COc2c(C)cc3oc4c(CC=C(C)C)ccc(O)c4c(=O)c3c2[C@@H]1O |
| InChI | InChI=1S/C25H26O5/c1-12(2)6-7-15-8-9-17(26)19-23(28)20-18(30-25(15)19)10-14(5)24-21(20)22(27)16(11-29-24)13(3)4/h6,8-10,16,22,26-27H,3,7,11H2,1-2,4-5H3/t16-,22-/m1/s1 |
| InChIKey | MXGMZMKTWCNKRS-OPAMFIHVSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| shamixanthone (CHEBI:64499) has role metabolite (CHEBI:25212) |
| shamixanthone (CHEBI:64499) is a cyclic ketone (CHEBI:3992) |
| shamixanthone (CHEBI:64499) is a phenols (CHEBI:33853) |
| shamixanthone (CHEBI:64499) is a pyranoxanthene (CHEBI:64515) |
| IUPAC Name |
|---|
| (1R,2S)-1,11-dihydroxy-5-methyl-8-(3-methylbut-2-en-1-yl)-2-(prop-1-en-2-yl)-2,3-dihydropyrano[3,2-a]xanthen-12(1H)-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1442631 | Reaxys |
| Citations |
|---|