EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10O6 |
| Net Charge | 0 |
| Average Mass | 226.184 |
| Monoisotopic Mass | 226.04774 |
| SMILES | CC(=O)c1c(O)cc(CCC(=O)O)oc1=O |
| InChI | InChI=1S/C10H10O6/c1-5(11)9-7(12)4-6(16-10(9)15)2-3-8(13)14/h4,12H,2-3H2,1H3,(H,13,14) |
| InChIKey | AHSXBCFJMIOPSN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cspyrone B1 (CHEBI:64497) has role fungal metabolite (CHEBI:76946) |
| cspyrone B1 (CHEBI:64497) is a 2-pyranones (CHEBI:75885) |
| cspyrone B1 (CHEBI:64497) is a aromatic ketone (CHEBI:76224) |
| cspyrone B1 (CHEBI:64497) is a methyl ketone (CHEBI:51867) |
| cspyrone B1 (CHEBI:64497) is a oxo monocarboxylic acid (CHEBI:35871) |
| IUPAC Name |
|---|
| 3-(3-acetyl-4-hydroxy-2-oxo-2H-pyran-6-yl)propanoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:20529735 | Reaxys |
| Citations |
|---|