EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H44FeN9O13 |
| Net Charge | 0 |
| Average Mass | 770.555 |
| Monoisotopic Mass | 770.24079 |
| SMILES | CC1=[O+][Fe-3]2345[O]N1CCC[C@@H]1NC(=O)CNC(=O)[C@H](CO)NC(=O)CNC(=O)[C@H](CCCN([O]2)C(C)=[O+]3)NC(=O)[C@H](CCCN([O]4)C(C)=[O+]5)NC1=O |
| InChI | InChI=1S/C28H44N9O13.Fe/c1-16(39)35(48)10-4-7-19-25(44)29-14-24(43)32-22(15-38)26(45)30-13-23(42)31-20(8-5-11-36(49)17(2)40)27(46)34-21(28(47)33-19)9-6-12-37(50)18(3)41;/h19-22,38H,4-15H2,1-3H3,(H,29,44)(H,30,45)(H,31,42)(H,32,43)(H,33,47)(H,34,46);/q-3;+3/t19-,20-,21-,22-;/m0./s1 |
| InChIKey | FNBCUYMSQPYITB-JZVQUOAUSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ferricrocin (CHEBI:64492) has role metabolite (CHEBI:25212) |
| ferricrocin (CHEBI:64492) is a ferrichromes (CHEBI:61414) |
| IUPAC Name |
|---|
| (cyclo{glycyl-L-serylglycyl-N5-(hydroxy-κO)-N5-[1-(oxo-κO)ethyl]-L-ornithyl-N5-(hydroxy-κO)-N5-[1-(oxo-κO)ethyl]-L-ornithyl-N5-hydroxy-κO-N5-[1-(oxo-κO)ethyl]-L-ornithyl})iron |
| Synonym | Source |
|---|---|
| (cyclic(glycyl-N5-acetyl-N5-hydroxy-L-ornithyl-N5-hydroxy-L-ornithyl-N5-acetyl-N5-hydroxy-L-ornithylgylcyl-L-seryl)ato(3−))iron | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| DB03574 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Reaxys:14537062 | Reaxys |
| CAS:23086-46-6 | ChemIDplus |
| Citations |
|---|