EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H52NO7P |
| Net Charge | 0 |
| Average Mass (excl. R groups) | 545.690 |
| Monoisotopic Mass (excl. R groups) | 545.34814 |
| SMILES | *C(=O)OC[C@@]([H])(O)COP(=O)([O-])OCC[N+](C)(C)C |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lysophosphatidylcholine 20:3/0:0 (CHEBI:64488) has role metabolite (CHEBI:25212) |
| lysophosphatidylcholine 20:3/0:0 (CHEBI:64488) is a lysophosphatidylcholine 20:3 (CHEBI:64481) |
| Incoming Relation(s) |
| 1-[(8Z,11Z,14Z)-icosatrienoyl]-sn-glycero-3-phosphocholine (CHEBI:86256) is a lysophosphatidylcholine 20:3/0:0 (CHEBI:64488) |
| 1-dihomo-linolenoyl-GPC (20:3n3 or n6) (CHEBI:234059) is a lysophosphatidylcholine 20:3/0:0 (CHEBI:64488) |
| Synonyms | Source |
|---|---|
| LPC(20:3/0:0) | ChEBI |
| LyPC(20:3/0:0) | ChEBI |
| LysoPC(20:3/0:0) | ChEBI |
| lysophosphatidylcholine(20:3/0:0) | ChEBI |
| PC 20:3/0:0 | ChEBI |
| Citations |
|---|