EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H4N3O2 |
| Net Charge | +1 |
| Average Mass | 150.117 |
| Monoisotopic Mass | 150.02980 |
| SMILES | N#[N+]c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C6H4N3O2/c7-8-5-3-1-2-4-6(5)9(10)11/h1-4H/q+1 |
| InChIKey | AYTSDBGAHOKDHJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-nitrobenzenediazonium (CHEBI:64467) has role hapten (CHEBI:59174) |
| 2-nitrobenzenediazonium (CHEBI:64467) is a aromatic diazonium ion (CHEBI:53507) |
| Incoming Relation(s) |
| (2-nitrophenyl)azo group (CHEBI:64664) is substituent group from 2-nitrobenzenediazonium (CHEBI:64467) |
| IUPAC Name |
|---|
| 2-nitrobenzenediazonium |
| Synonyms | Source |
|---|---|
| ortho-nitrobenzeneazo | ChEBI |
| o-nitrobenzeneazo | ChEBI |
| 2-nitrophenyldiazonium | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:25910-37-6 | ChemIDplus |
| Citations |
|---|