EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H10O7 |
| Net Charge | 0 |
| Average Mass | 314.249 |
| Monoisotopic Mass | 314.04265 |
| SMILES | Cc1cc2c(c(O)c1C(=O)O)C(=O)c1c(O)cc(O)cc1C2=O |
| InChI | InChI=1S/C16H10O7/c1-5-2-7-12(14(20)10(5)16(22)23)15(21)11-8(13(7)19)3-6(17)4-9(11)18/h2-4,17-18,20H,1H3,(H,22,23) |
| InChIKey | UZOHDKGTYVTYDZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| endocrocin (CHEBI:64450) has role metabolite (CHEBI:25212) |
| endocrocin (CHEBI:64450) is a monocarboxylic acid (CHEBI:25384) |
| endocrocin (CHEBI:64450) is a phenols (CHEBI:33853) |
| endocrocin (CHEBI:64450) is a trihydroxyanthraquinone (CHEBI:37488) |
| IUPAC Name |
|---|
| 1,6,8-trihydroxy-3-methyl-9,10-dioxo-9,10-dihydroanthracene-2-carboxylic acid |
| Synonym | Source |
|---|---|
| 9,10-dihydro-1,6,8-trihydroxy-3-methyl-9,10-dioxo-2-anthracenecarboxylic acid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2226192 | Reaxys |
| CAS:481-70-9 | ChemIDplus |
| Citations |
|---|