EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H5AsN2O3 |
| Net Charge | 0 |
| Average Mass | 228.039 |
| Monoisotopic Mass | 227.95161 |
| SMILES | N#[N+]c1ccccc1[As](=O)([O-])O |
| InChI | InChI=1S/C6H5AsN2O3/c8-9-6-4-2-1-3-5(6)7(10,11)12/h1-4H,(H-,10,11,12) |
| InChIKey | CUIBTWXAZHDHTN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2-diazoniophenyl)arsonate (CHEBI:64447) has functional parent phenylarsonate(1−) (CHEBI:64449) |
| (2-diazoniophenyl)arsonate (CHEBI:64447) has role hapten (CHEBI:59174) |
| (2-diazoniophenyl)arsonate (CHEBI:64447) is a aromatic diazonium ion (CHEBI:53507) |
| Incoming Relation(s) |
| [2-(hydroxyarsinato)phenyl]azo group (CHEBI:64660) is substituent group from (2-diazoniophenyl)arsonate (CHEBI:64447) |
| IUPAC Name |
|---|
| hydrogen (2-diazoniophenyl)arsonate |
| Synonyms | Source |
|---|---|
| o-azobenzenearsonate | ChEBI |
| ortho-azobenzenearsonate | ChEBI |
| 1-benzenediazonium-2-arsonate | ChEBI |
| phenyldiazonium-2-arsonate | ChEBI |
| (o-diazoniophenyl)arsonate | ChEBI |
| Citations |
|---|