EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H4N2O2 |
| Net Charge | 0 |
| Average Mass | 148.121 |
| Monoisotopic Mass | 148.02728 |
| SMILES | N#[N+]c1cccc(C(=O)[O-])c1 |
| InChI | InChI=1S/C7H4N2O2/c8-9-6-3-1-2-5(4-6)7(10)11/h1-4H |
| InChIKey | JGDVEGYTXVVWGW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-diazoniobenzoate (CHEBI:64438) has functional parent benzoate (CHEBI:16150) |
| 3-diazoniobenzoate (CHEBI:64438) has role hapten (CHEBI:59174) |
| 3-diazoniobenzoate (CHEBI:64438) is a aromatic diazonium ion (CHEBI:53507) |
| Incoming Relation(s) |
| (3-carboxylatophenyl)azo group (CHEBI:64658) is substituent group from 3-diazoniobenzoate (CHEBI:64438) |
| IUPAC Name |
|---|
| 3-diazoniobenzoate |
| Synonyms | Source |
|---|---|
| 1-benzenediazonium-3-carboxylate | ChEBI |
| 3-carboxybenzenediazonium, inner salt | ChEBI |
| m-azobenzoate | ChEBI |
| m-benzenediazonium carboxylate | ChEBI |
| m-carboxybenzenediazonium, inner salt | ChEBI |
| m-diazoniobenzoate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3666719 | Reaxys |
| Citations |
|---|