EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10O3 |
| Net Charge | 0 |
| Average Mass | 178.187 |
| Monoisotopic Mass | 178.06299 |
| SMILES | O=C(O)CCC(=O)c1ccccc1 |
| InChI | InChI=1S/C10H10O3/c11-9(6-7-10(12)13)8-4-2-1-3-5-8/h1-5H,6-7H2,(H,12,13) |
| InChIKey | KMQLIDDEQAJAGJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-oxo-4-phenylbutyric acid (CHEBI:64437) has functional parent butyric acid (CHEBI:30772) |
| 4-oxo-4-phenylbutyric acid (CHEBI:64437) has role hapten (CHEBI:59174) |
| 4-oxo-4-phenylbutyric acid (CHEBI:64437) is a 4-oxo monocarboxylic acid (CHEBI:35950) |
| IUPAC Name |
|---|
| 4-oxo-4-phenylbutanoic acid |
| Synonyms | Source |
|---|---|
| 3-Benzoylpropionic acid | ChemIDplus |
| 3-Benzoylpropanoic acid | ChemIDplus |
| beta-Benzoylpropionic acid | ChemIDplus |
| Benzoylpropionic acid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:639757 | Reaxys |
| CAS:2051-95-8 | ChemIDplus |
| Citations |
|---|