EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H28O6 |
| Net Charge | 0 |
| Average Mass | 424.493 |
| Monoisotopic Mass | 424.18859 |
| SMILES | CC(C)=CCOc1c(C)cc(O)c2c1C(O)Oc1ccc(CC=C(C)C)c(O)c1C2=O |
| InChI | InChI=1S/C25H28O6/c1-13(2)6-7-16-8-9-18-20(22(16)27)23(28)19-17(26)12-15(5)24(21(19)25(29)31-18)30-11-10-14(3)4/h6,8-10,12,25-27,29H,7,11H2,1-5H3 |
| InChIKey | WFHNNILBVLUOKP-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Emericella rugulosa (ncbitaxon:41736) | - | PubMed (22026385) | |
| Aspergillus (ncbitaxon:5052) | - | PubMed (22026385) | |
| Aspergillus nidulans (ncbitaxon:162425) | - | PubMed (22026385) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| arugosin A (lactol form) (CHEBI:64435) is a arugosin A (CHEBI:64440) |
| arugosin A (lactol form) (CHEBI:64435) is a cyclic ketone (CHEBI:3992) |
| arugosin A (lactol form) (CHEBI:64435) is a dibenzooxepine (CHEBI:38926) |
| arugosin A (lactol form) (CHEBI:64435) is a lactol (CHEBI:38131) |
| arugosin A (lactol form) (CHEBI:64435) is a polyphenol (CHEBI:26195) |
| arugosin A (lactol form) (CHEBI:64435) is tautomer of arugosin A (hydroxy-aldehyde form) (CHEBI:64439) |
| Incoming Relation(s) |
| arugosin A (hydroxy-aldehyde form) (CHEBI:64439) is tautomer of arugosin A (lactol form) (CHEBI:64435) |
| IUPAC Name |
|---|
| 1,6,10-trihydroxy-8-methyl-2-(3-methylbut-2-en-1-yl)-7-[(3-methylbut-2-en-1-yl)oxy]dibenzo[b,e]oxepin-11(6H)-one |
| Synonym | Source |
|---|---|
| arugosin A (hemiacetal form) | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2025563 | Reaxys |
| Citations |
|---|