EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H8O3S |
| Net Charge | 0 |
| Average Mass | 184.216 |
| Monoisotopic Mass | 184.01942 |
| SMILES | O=C(O)CCC(=O)c1cccs1 |
| InChI | InChI=1S/C8H8O3S/c9-6(3-4-8(10)11)7-2-1-5-12-7/h1-2,5H,3-4H2,(H,10,11) |
| InChIKey | ULJMYWHLMLRYSO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-oxo-4-(2-thienyl)butyric acid (CHEBI:64434) has functional parent butyric acid (CHEBI:30772) |
| 4-oxo-4-(2-thienyl)butyric acid (CHEBI:64434) has role hapten (CHEBI:59174) |
| 4-oxo-4-(2-thienyl)butyric acid (CHEBI:64434) is a 4-oxo monocarboxylic acid (CHEBI:35950) |
| 4-oxo-4-(2-thienyl)butyric acid (CHEBI:64434) is a thiophenes (CHEBI:26961) |
| IUPAC Name |
|---|
| 4-oxo-4-(2-thienyl)butanoic acid |
| Synonyms | Source |
|---|---|
| 3-(2-thenoyl)propanoic acid | ChEBI |
| 3-(2-Thenoyl)propionic acid | ChemIDplus |
| 4-(2-thiophenyl)-4-oxobutanoic acid | ChEBI |
| 4-oxo-4-(2-thiophenyl)butanoic acid | ChEBI |
| 4-oxo-4-(thien-2-yl)butanoic acid | ChEBI |
| 4-oxo-4-(thien-2-yl)butyric acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| EP1873144 | Patent |
| US2005171346 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:133870 | Reaxys |
| CAS:4653-08-1 | ChemIDplus |
| Citations |
|---|