EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H18N2O |
| Net Charge | 0 |
| Average Mass | 254.333 |
| Monoisotopic Mass | 254.14191 |
| SMILES | CN[C@@H]1Cc2cnc3cccc(c23)[C@H]1/C=C(\C)C=O |
| InChI | InChI=1S/C16H18N2O/c1-10(9-19)6-13-12-4-3-5-14-16(12)11(8-18-14)7-15(13)17-2/h3-6,8-9,13,15,17-18H,7H2,1-2H3/b10-6+/t13-,15-/m1/s1 |
| InChIKey | XFKPUSAZRRAPSC-HEESEWQSSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chanoclavine-I aldehyde (CHEBI:64429) has functional parent chanoclavine-I (CHEBI:3576) |
| chanoclavine-I aldehyde (CHEBI:64429) is a enal (CHEBI:51688) |
| chanoclavine-I aldehyde (CHEBI:64429) is a ergot alkaloid (CHEBI:23943) |
| chanoclavine-I aldehyde (CHEBI:64429) is a organic heterotricyclic compound (CHEBI:26979) |
| chanoclavine-I aldehyde (CHEBI:64429) is a secondary amino compound (CHEBI:50995) |
| chanoclavine-I aldehyde (CHEBI:64429) is conjugate base of chanoclavine-I aldehyde(1+) (CHEBI:71487) |
| Incoming Relation(s) |
| chanoclavine-I aldehyde(1+) (CHEBI:71487) is conjugate acid of chanoclavine-I aldehyde (CHEBI:64429) |
| IUPAC Name |
|---|
| (2E)-2-methyl-3-[(4R,5R)-4-(methylamino)-1,3,4,5-tetrahydrobenzo[cd]indol-5-yl]prop-2-enal |
| Registry Numbers | Sources |
|---|---|
| Reaxys:20087508 | Reaxys |
| Citations |
|---|