EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H28O8 |
| Net Charge | 0 |
| Average Mass | 456.491 |
| Monoisotopic Mass | 456.17842 |
| SMILES | C=C1[C@]23C(=O)O[C@@H](C)[C@@]24O[C@]2(C(=C)[C@@]5(C=CC(=O)OC5(C)C)CC[C@@]32C)[C@@H](O)[C@]1(C)OC4=O |
| InChI | InChI=1S/C25H28O8/c1-12-21(7)16(27)24-13(2)22(9-8-15(26)31-19(22,4)5)11-10-20(24,6)23(12)17(28)30-14(3)25(23,33-24)18(29)32-21/h8-9,14,16,27H,1-2,10-11H2,3-7H3/t14-,16-,20-,21+,22+,23+,24+,25-/m0/s1 |
| InChIKey | IQBUQLYYAHHCGX-LRSNFHFMSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dehydroaustinol (CHEBI:64421) is a meroterpenoid (CHEBI:64419) |
| IUPAC Name |
|---|
| (1'R,2'S,3S,7'S,8'S,9'R,12'S,13'S)-8'-hydroxy-2,2,2',9',13'-pentamethyl-6',16'-bis(methylene)-6H-spiro[pyran-3,5'-[10,14,17]trioxapentacyclo[7.6.1.17,12.01,12.02,7]heptadecane]-6,11',15'-trione |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6832795 | Reaxys |
| Citations |
|---|