EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H14O3 |
| Net Charge | 0 |
| Average Mass | 230.263 |
| Monoisotopic Mass | 230.09429 |
| SMILES | Cc1cc(O)cc(Oc2cc(C)cc(O)c2)c1 |
| InChI | InChI=1S/C14H14O3/c1-9-3-11(15)7-13(5-9)17-14-6-10(2)4-12(16)8-14/h3-8,15-16H,1-2H3 |
| InChIKey | SPCJQQBYWVGMQG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ascomycota sp. Ind19F07 (ncbitaxon:1583058) | - | PubMed (25537370) |
| Roles Classification |
|---|
| Biological Roles: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diorcinol (CHEBI:64413) has role fungal metabolite (CHEBI:76946) |
| diorcinol (CHEBI:64413) has role marine metabolite (CHEBI:76507) |
| diorcinol (CHEBI:64413) has role metabolite (CHEBI:25212) |
| diorcinol (CHEBI:64413) is a aromatic ether (CHEBI:35618) |
| diorcinol (CHEBI:64413) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 3,3'-oxybis(5-methylphenol) |
| Synonym | Source |
|---|---|
| 3,3'-dihydroxy-5,5'-dimethyldiphenyl ether | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2272621 | Reaxys |
| Citations |
|---|