EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H14O3 |
| Net Charge | 0 |
| Average Mass | 230.263 |
| Monoisotopic Mass | 230.09429 |
| SMILES | Cc1cc(O)cc(Oc2cc(C)cc(O)c2)c1 |
| InChI | InChI=1S/C14H14O3/c1-9-3-11(15)7-13(5-9)17-14-6-10(2)4-12(16)8-14/h3-8,15-16H,1-2H3 |
| InChIKey | SPCJQQBYWVGMQG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ascomycota sp. Ind19F07 (ncbitaxon:1583058) | - | PubMed (25537370) |
| Roles Classification |
|---|
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diorcinol (CHEBI:64413) has role fungal metabolite (CHEBI:76946) |
| diorcinol (CHEBI:64413) has role marine metabolite (CHEBI:76507) |
| diorcinol (CHEBI:64413) has role metabolite (CHEBI:25212) |
| diorcinol (CHEBI:64413) is a aromatic ether (CHEBI:35618) |
| diorcinol (CHEBI:64413) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 3,3'-oxybis(5-methylphenol) |
| Synonym | Source |
|---|---|
| 3,3'-dihydroxy-5,5'-dimethyldiphenyl ether | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2272621 | Reaxys |
| Citations |
|---|