EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H14O5 |
| Net Charge | 0 |
| Average Mass | 274.272 |
| Monoisotopic Mass | 274.08412 |
| SMILES | Cc1cc(O)cc(Oc2cc(C)c(C(=O)O)c(O)c2)c1 |
| InChI | InChI=1S/C15H14O5/c1-8-3-10(16)6-11(4-8)20-12-5-9(2)14(15(18)19)13(17)7-12/h3-7,16-17H,1-2H3,(H,18,19) |
| InChIKey | ZJEIMBOWRAUNAN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 10-deoxygerfelin (CHEBI:64412) has role metabolite (CHEBI:25212) |
| 10-deoxygerfelin (CHEBI:64412) is a aromatic ether (CHEBI:35618) |
| 10-deoxygerfelin (CHEBI:64412) is a benzoic acids (CHEBI:22723) |
| 10-deoxygerfelin (CHEBI:64412) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 2-hydroxy-4-(3-hydroxy-5-methylphenoxy)-6-methylbenzoic acid |
| Synonyms | Source |
|---|---|
| C-10-deoxy derivative of gerfelin | ChEBI |
| C10-deoxy derivative of gerfelin | ChEBI |
| C-10-deoxy gerfelin | ChEBI |
| C-10-deoxygerfelin | ChEBI |
| C10-deoxy gerfelin | ChEBI |
| C10-deoxygerfelin | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2663280 | Reaxys |
| Citations |
|---|