EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H14O6 |
| Net Charge | 0 |
| Average Mass | 290.271 |
| Monoisotopic Mass | 290.07904 |
| SMILES | Cc1cc(O)c(O)c(Oc2cc(C)c(C(=O)O)c(O)c2)c1 |
| InChI | InChI=1S/C15H14O6/c1-7-3-11(17)14(18)12(4-7)21-9-5-8(2)13(15(19)20)10(16)6-9/h3-6,16-18H,1-2H3,(H,19,20) |
| InChIKey | BGSIXQHNQUBHAX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | EC 2.5.1.29 (geranylgeranyl diphosphate synthase) inhibitor An EC 2.5.1.* (non-methyl-alkyl or aryl transferase) inhibitor that interferes with the action of geranylgeranyl diphosphate synthase (EC 2.5.1.29). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gerfelin (CHEBI:64410) has role EC 2.5.1.29 (geranylgeranyl diphosphate synthase) inhibitor (CHEBI:64411) |
| gerfelin (CHEBI:64410) has role metabolite (CHEBI:25212) |
| gerfelin (CHEBI:64410) is a aromatic ether (CHEBI:35618) |
| gerfelin (CHEBI:64410) is a benzoic acids (CHEBI:22723) |
| gerfelin (CHEBI:64410) is a catechols (CHEBI:33566) |
| Synonym | Source |
|---|---|
| 4-(2,3-dihydroxy-5-methylphenoxy)-2-hydroxy-6-methylbenzoic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11076226 | Reaxys |
| CAS:627545-07-7 | ChemIDplus |
| Citations |
|---|