EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H14O6 |
| Net Charge | 0 |
| Average Mass | 290.271 |
| Monoisotopic Mass | 290.07904 |
| SMILES | Cc1cc(O)c(O)c(Oc2cc(C)c(C(=O)O)c(O)c2)c1 |
| InChI | InChI=1S/C15H14O6/c1-7-3-11(17)14(18)12(4-7)21-9-5-8(2)13(15(19)20)10(16)6-9/h3-6,16-18H,1-2H3,(H,19,20) |
| InChIKey | BGSIXQHNQUBHAX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 2.5.1.29 (geranylgeranyl diphosphate synthase) inhibitor An EC 2.5.1.* (non-methyl-alkyl or aryl transferase) inhibitor that interferes with the action of geranylgeranyl diphosphate synthase (EC 2.5.1.29). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gerfelin (CHEBI:64410) has role EC 2.5.1.29 (geranylgeranyl diphosphate synthase) inhibitor (CHEBI:64411) |
| gerfelin (CHEBI:64410) has role metabolite (CHEBI:25212) |
| gerfelin (CHEBI:64410) is a aromatic ether (CHEBI:35618) |
| gerfelin (CHEBI:64410) is a benzoic acids (CHEBI:22723) |
| gerfelin (CHEBI:64410) is a catechols (CHEBI:33566) |
| Synonym | Source |
|---|---|
| 4-(2,3-dihydroxy-5-methylphenoxy)-2-hydroxy-6-methylbenzoic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11076226 | Reaxys |
| CAS:627545-07-7 | ChemIDplus |
| Citations |
|---|