EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H31NO2 |
| Net Charge | 0 |
| Average Mass | 353.506 |
| Monoisotopic Mass | 353.23548 |
| SMILES | CC[C@H](OC(C)=O)C(C[C@H](C)N(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H31NO2/c1-6-22(26-19(3)25)23(17-18(2)24(4)5,20-13-9-7-10-14-20)21-15-11-8-12-16-21/h7-16,18,22H,6,17H2,1-5H3/t18-,22-/m0/s1 |
| InChIKey | XBMIVRRWGCYBTQ-AVRDEDQJSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | mu-opioid receptor antagonist Any compound that exhibits antagonist activity at the μ-opioid receptor opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. |
| Applications: | mu-opioid receptor antagonist Any compound that exhibits antagonist activity at the μ-opioid receptor opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| levacetylmethadol (CHEBI:6441) has role opioid analgesic (CHEBI:35482) |
| levacetylmethadol (CHEBI:6441) has role μ-opioid receptor antagonist (CHEBI:50137) |
| levacetylmethadol (CHEBI:6441) is a acetate ester (CHEBI:47622) |
| levacetylmethadol (CHEBI:6441) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| (3S,6S)-6-(dimethylamino)-4,4-diphenylheptan-2-yl acetate |
| INNs | Source |
|---|---|
| levacetilmetadol | DrugBank |
| levacetylmethadol | KEGG DRUG |
| levacetylmethadolum | DrugBank |
| Synonyms | Source |
|---|---|
| 1-alpha-Acetylmethadol | ChemIDplus |
| (1S,4S)-4-(dimethylamino)-1-ethyl-2,2-diphenylpentyl acetate | IUPAC |
| (-)-alpha-Acetylmethadol | ChemIDplus |
| LAAM | ChemIDplus |
| LAAM | KEGG COMPOUND |
| Levacetylmethadol | ChemIDplus |
| Brand Name | Source |
|---|---|
| Orlaam | DrugBank |