EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H18O7 |
| Net Charge | 0 |
| Average Mass | 394.379 |
| Monoisotopic Mass | 394.10525 |
| SMILES | CC1=CC(=O)C2(C)C(=O)C3=C(O)C(=O)C4=C(Oc5cc(C)cc(O)c5O4)C3(C)C12 |
| InChI | InChI=1S/C22H18O7/c1-8-5-10(23)16-11(6-8)28-20-17(29-16)15(26)14(25)13-19(27)21(3)12(24)7-9(2)18(21)22(13,20)4/h5-7,18,23,25H,1-4H3 |
| InChIKey | BDVPUNXXZLFREO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 3.4.22.38 (cathepsin K) inhibitor A cysteine protease inhibitor which inhibits cathepsin K (EC 3.4.22.38). fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| F-9775A (CHEBI:64405) has role EC 3.4.22.38 (cathepsin K) inhibitor (CHEBI:64406) |
| F-9775A (CHEBI:64405) has role fungal metabolite (CHEBI:76946) |
| F-9775A (CHEBI:64405) is a organic heteropentacyclic compound (CHEBI:38164) |
| F-9775A (CHEBI:64405) is a phenols (CHEBI:33853) |
| F-9775A (CHEBI:64405) is a polyketide (CHEBI:26188) |
| IUPAC Name |
|---|
| 4,7-dihydroxy-2,8a,11,11b-tetramethyl-11a,11b-dihydrobenzo[b]cyclopenta[2,3]indeno[4,5-e][1,4]dioxine-6,8,9(8aH)-trione |
| Citations |
|---|