EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12O6 |
| Net Charge | 0 |
| Average Mass | 288.255 |
| Monoisotopic Mass | 288.06339 |
| SMILES | Cc1cc(O)c(C(=O)c2c(O)cccc2O)c(C(=O)O)c1 |
| InChI | InChI=1S/C15H12O6/c1-7-5-8(15(20)21)12(11(18)6-7)14(19)13-9(16)3-2-4-10(13)17/h2-6,16-18H,1H3,(H,20,21) |
| InChIKey | UMNWQJSVQOCNEM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| monodictyphenone (CHEBI:64398) has role metabolite (CHEBI:25212) |
| monodictyphenone (CHEBI:64398) is a benzoic acids (CHEBI:22723) |
| monodictyphenone (CHEBI:64398) is a benzophenones (CHEBI:22726) |
| monodictyphenone (CHEBI:64398) is a monocarboxylic acid (CHEBI:25384) |
| monodictyphenone (CHEBI:64398) is a resorcinols (CHEBI:33572) |
| IUPAC Name |
|---|
| 2-(2,6-dihydroxybenzoyl)-3-hydroxy-5-methylbenzoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11058831 | Reaxys |
| Citations |
|---|