EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H24O5 |
| Net Charge | 0 |
| Average Mass | 332.396 |
| Monoisotopic Mass | 332.16237 |
| SMILES | CC[C@H](C)/C=C(C)/C=C/C(=O)c1occ2c1C[C@@H](O)[C@](C)(O)C2=O |
| InChI | InChI=1S/C19H24O5/c1-5-11(2)8-12(3)6-7-15(20)17-13-9-16(21)19(4,23)18(22)14(13)10-24-17/h6-8,10-11,16,21,23H,5,9H2,1-4H3/b7-6+,12-8+/t11-,16+,19-/m0/s1 |
| InChIKey | ZNGSMORVYUMUDS-BYQFYWKXSA-N |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| asperfuranone (CHEBI:64397) has role antineoplastic agent (CHEBI:35610) |
| asperfuranone (CHEBI:64397) has role fungal metabolite (CHEBI:76946) |
| asperfuranone (CHEBI:64397) is a 2-benzofurans (CHEBI:38831) |
| asperfuranone (CHEBI:64397) is a cyclic ketone (CHEBI:3992) |
| asperfuranone (CHEBI:64397) is a diol (CHEBI:23824) |
| asperfuranone (CHEBI:64397) is a polyketide (CHEBI:26188) |
| asperfuranone (CHEBI:64397) is a secondary alcohol (CHEBI:35681) |
| asperfuranone (CHEBI:64397) is a tertiary alcohol (CHEBI:26878) |
| asperfuranone (CHEBI:64397) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| IUPAC Name |
|---|
| (5S,6R)-1-[(2E,4E,6S)-4,6-dimethylocta-2,4-dienoyl]-5,6-dihydroxy-5-methyl-6,7-dihydro-2-benzofuran-4(5H)-one |
| UniProt Name | Source |
|---|---|
| asperfuranone | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19447395 | Reaxys |
| Citations |
|---|