EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H25NO3.HCl |
| Net Charge | 0 |
| Average Mass | 327.852 |
| Monoisotopic Mass | 327.16012 |
| SMILES | CC(C)(C)NC[C@H](O)COc1cccc2c1CCCC2=O.Cl |
| InChI | InChI=1S/C17H25NO3.ClH/c1-17(2,3)18-10-12(19)11-21-16-9-5-6-13-14(16)7-4-8-15(13)20;/h5-6,9,12,18-19H,4,7-8,10-11H2,1-3H3;1H/t12-;/m0./s1 |
| InChIKey | DNTDOBSIBZKFCP-YDALLXLXSA-N |
| Roles Classification |
|---|
| Biological Role: | beta-adrenergic antagonist An agent that binds to but does not activate β-adrenergic receptors thereby blocking the actions of endogenous or exogenous β-adrenergic agonists. β-Adrenergic antagonists are used for treatment of hypertension, cardiac arrhythmias, angina pectoris, glaucoma, migraine headaches and anxiety. |
| Applications: | antiglaucoma drug Any drug which can be used to prevent or alleviate glaucoma, a disease in which the optic nerve is damaged, resulting in progressive, irreversible loss of vision. It is often, though not always, associated with increased pressure of the fluid in the eye. beta-adrenergic antagonist An agent that binds to but does not activate β-adrenergic receptors thereby blocking the actions of endogenous or exogenous β-adrenergic agonists. β-Adrenergic antagonists are used for treatment of hypertension, cardiac arrhythmias, angina pectoris, glaucoma, migraine headaches and anxiety. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| levobunolol hydrochloride (CHEBI:6439) has part levobunolol(1+) (CHEBI:72567) |
| levobunolol hydrochloride (CHEBI:6439) has role antiglaucoma drug (CHEBI:39456) |
| levobunolol hydrochloride (CHEBI:6439) has role β-adrenergic antagonist (CHEBI:35530) |
| levobunolol hydrochloride (CHEBI:6439) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 5-[(2S)-3-(tert-butylamino)-2-hydroxypropoxy]-3,4-dihydronaphthalen-1(2H)-one hydrochloride |
| Synonyms | Source |
|---|---|
| levobunolol hydrochloride | KEGG COMPOUND |
| (2S)-N-(tert-butyl)-2-hydroxy-3-[(5-oxo-5,6,7,8-tetrahydronaphthalen-1-yl)oxy]propan-1-aminium chloride | IUPAC |
| (−)-3,4-dihydro-5-(3-(tert-butylamino)-2-hydroxypropoxy)-1(2H)-naphthalenone hydrochloride | ChemIDplus |
| levobunolol HCl | ChemIDplus |
| (−)-5-(3-(tert-butylamino)-2-hydroxypropoxy)-3,4-dihydro-1(2H)-naphthalenone hydrochloride | ChemIDplus |
| levobunolol monohydrochloride | ChEBI |
| Brand Name | Source |
|---|---|
| Betagan | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D01025 | KEGG DRUG |
| DBSALT000251 | DrugBank |
| US5733938 | Patent |
| US6159458 | Patent |
| WO2008002929 | Patent |
| WO2007034140 | Patent |
| CN101342163 | Patent |
| JP2008094780 | Patent |
| Registry Numbers | Sources |
|---|---|
| CAS:27912-14-7 | KEGG COMPOUND |
| CAS:27912-14-7 | ChemIDplus |
| Citations |
|---|