EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H11NO6S4.2Na |
| Net Charge | 0 |
| Average Mass | 355.392 |
| Monoisotopic Mass | 354.92646 |
| SMILES | CN(C)C(CSS(=O)(=O)[O-])CSS(=O)(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C5H13NO6S4.2Na/c1-6(2)5(3-13-15(7,8)9)4-14-16(10,11)12;;/h5H,3-4H2,1-2H3,(H,7,8,9)(H,10,11,12);;/q;2*+1/p-2 |
| InChIKey | QSOHVSNIQHGFJU-UHFFFAOYSA-L |
| Roles Classification |
|---|
| Application: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thiosultap disodium (CHEBI:64384) has part thiosultap(2−) (CHEBI:64385) |
| thiosultap disodium (CHEBI:64384) has role insecticide (CHEBI:24852) |
| thiosultap disodium (CHEBI:64384) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| disodium S,S'-[2-(dimethylamino)propane-1,3-diyl] disulfurothioate |
| Synonyms | Source |
|---|---|
| Disodium S,S'-(2-dimethylamino-1,3-propanediyl)bis(thiosulfate) | ChemIDplus |
| Sha chong shuang | ChemIDplus |
| thiosultap-sodium | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 1487 | PPDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11322124 | Reaxys |
| CAS:52207-48-4 | ChemIDplus |
| Citations |
|---|