EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H25NO3 |
| Net Charge | 0 |
| Average Mass | 291.391 |
| Monoisotopic Mass | 291.18344 |
| SMILES | CC(C)(C)NC[C@H](O)COc1cccc2c1CCCC2=O |
| InChI | InChI=1S/C17H25NO3/c1-17(2,3)18-10-12(19)11-21-16-9-5-6-13-14(16)7-4-8-15(13)20/h5-6,9,12,18-19H,4,7-8,10-11H2,1-3H3/t12-/m0/s1 |
| InChIKey | IXHBTMCLRNMKHZ-LBPRGKRZSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | beta-adrenergic antagonist An agent that binds to but does not activate β-adrenergic receptors thereby blocking the actions of endogenous or exogenous β-adrenergic agonists. β-Adrenergic antagonists are used for treatment of hypertension, cardiac arrhythmias, angina pectoris, glaucoma, migraine headaches and anxiety. |
| Applications: | beta-adrenergic antagonist An agent that binds to but does not activate β-adrenergic receptors thereby blocking the actions of endogenous or exogenous β-adrenergic agonists. β-Adrenergic antagonists are used for treatment of hypertension, cardiac arrhythmias, angina pectoris, glaucoma, migraine headaches and anxiety. antiglaucoma drug Any drug which can be used to prevent or alleviate glaucoma, a disease in which the optic nerve is damaged, resulting in progressive, irreversible loss of vision. It is often, though not always, associated with increased pressure of the fluid in the eye. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| levobunolol (CHEBI:6438) has parent hydride tetralin (CHEBI:35008) |
| levobunolol (CHEBI:6438) has role antiglaucoma drug (CHEBI:39456) |
| levobunolol (CHEBI:6438) has role β-adrenergic antagonist (CHEBI:35530) |
| levobunolol (CHEBI:6438) is a aromatic ether (CHEBI:35618) |
| levobunolol (CHEBI:6438) is a cyclic ketone (CHEBI:3992) |
| levobunolol (CHEBI:6438) is a propanolamine (CHEBI:35533) |
| levobunolol (CHEBI:6438) is conjugate base of levobunolol(1+) (CHEBI:72567) |
| Incoming Relation(s) |
| dihydrolevobunolol (CHEBI:30268) has functional parent levobunolol (CHEBI:6438) |
| levobunolol(1+) (CHEBI:72567) is conjugate acid of levobunolol (CHEBI:6438) |
| IUPAC Name |
|---|
| 5-[(2S)-3-(tert-butylamino)-2-hydroxypropoxy]-3,4-dihydronaphthalen-1(2H)-one |
| INN | Source |
|---|---|
| levobunololum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (-)-Bunolol | KEGG COMPOUND |
| Bunolol, (-)- | ChEMBL |
| Bunolol, (s)- | ChEMBL |
| (S)-5-(3-((1,1-dimethylethyl)amino)-2-hydroxypropoxy)-3,4-dihydro-1(2H)-naphthalenone | ChemIDplus |
| Levobunolol | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 431 | DrugCentral |
| C07914 | KEGG COMPOUND |
| D08115 | KEGG DRUG |
| DB01210 | DrugBank |
| HMDB0015341 | HMDB |
| Levobunolol | Wikipedia |
| LSM-6578 | LINCS |
| US2011263638 | Patent |
| US2011275617 | Patent |
| WO2008002929 | Patent |
| WO2011140194 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6484587 | Reaxys |
| CAS:47141-42-4 | ChemIDplus |
| CAS:47141-42-4 | KEGG COMPOUND |
| Citations |
|---|