EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H14N2O2 |
| Net Charge | 0 |
| Average Mass | 170.212 |
| Monoisotopic Mass | 170.10553 |
| SMILES | CC[C@@H](C(N)=O)N1CCCC1=O |
| InChI | InChI=1S/C8H14N2O2/c1-2-6(8(9)12)10-5-3-4-7(10)11/h6H,2-5H2,1H3,(H2,9,12)/t6-/m0/s1 |
| InChIKey | HPHUVLMMVZITSG-LURJTMIESA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Application: | anticonvulsant A drug used to prevent seizures or reduce their severity. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| levetiracetam (CHEBI:6437) has role anticonvulsant (CHEBI:35623) |
| levetiracetam (CHEBI:6437) has role environmental contaminant (CHEBI:78298) |
| levetiracetam (CHEBI:6437) has role xenobiotic (CHEBI:35703) |
| levetiracetam (CHEBI:6437) is a pyrrolidin-2-ones (CHEBI:74223) |
| IUPAC Name |
|---|
| (2S)-2-(2-oxopyrrolidin-1-yl)butanamide |
| INNs | Source |
|---|---|
| levetiracetam | ChemIDplus |
| levetiracetamum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (S)-(−)-α-ethyl-2-oxo-1-pyrrolidineacetamide | ChEBI |
| (S)-α-ethyl-2-oxo-1-pyrrolidineacetamide | ChemIDplus |
| (−)-(S)-α-ethyl-2-oxo-1-pyrrolidineacetamide | ChemIDplus |
| Levetiracetam | KEGG COMPOUND |
| UCB-L 059 | ChemIDplus |
| Brand Name | Source |
|---|---|
| Keppra | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8407472 | Reaxys |
| CAS:102767-28-2 | KEGG COMPOUND |
| CAS:102767-28-2 | ChemIDplus |
| Citations |
|---|