EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12N2O3 |
| Net Charge | 0 |
| Average Mass | 160.173 |
| Monoisotopic Mass | 160.08479 |
| SMILES | CCN[C@@H](CC(N)=O)C(=O)O |
| InChI | InChI=1S/C6H12N2O3/c1-2-8-4(6(10)11)3-5(7)9/h4,8H,2-3H2,1H3,(H2,7,9)(H,10,11)/t4-/m0/s1 |
| InChIKey | OLNLSTNFRUFTLM-BYPYZUCNSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-ethyl-L-asparagine (CHEBI:64367) is a N-ethylasparagine (CHEBI:64308) |
| N-ethyl-L-asparagine (CHEBI:64367) is a L-asparagine derivative (CHEBI:52987) |
| N-ethyl-L-asparagine (CHEBI:64367) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| Synonyms | Source |
|---|---|
| N2-ethyl-L-asparagine | ChEBI |
| EtAsn | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:7195-20-2 | ChemIDplus |