EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | [H][C@@]1([C@@H](C)CCC=C(C)C)C=CC(=C)CC1 |
| InChI | InChI=1S/C15H24/c1-12(2)6-5-7-14(4)15-10-8-13(3)9-11-15/h6,8,10,14-15H,3,5,7,9,11H2,1-2,4H3/t14-,15+/m0/s1 |
| InChIKey | PHWISBHSBNDZDX-LSDHHAIUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Zingiber officinale (ncbitaxon:94328) | rhizome (BTO:0001181) | PubMed (8064299) | Dried rhizomes |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-sesquiphellandrene (CHEBI:64361) has role plant metabolite (CHEBI:76924) |
| β-sesquiphellandrene (CHEBI:64361) is a alicyclic compound (CHEBI:33654) |
| β-sesquiphellandrene (CHEBI:64361) is a sesquiterpene (CHEBI:35189) |
| IUPAC Name |
|---|
| (3R)-3-[(2S)-6-methylhept-5-en-2-yl]-6-methylidenecyclohexene |
| Synonyms | Source |
|---|---|
| beta-sesquiphellandrene | SUBMITTER |
| (−)-β-sesquiphellandrene | ChEBI |
| (−)-(6R,7S)-sesquiphellandrene | ChEBI |
| (R)-3-methylene-6-[(S)-6-methylhept-5-en-2-yl]-cyclohex-1-ene | ChEBI |
| (-)-beta-Sesquiphellandrene | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| β-sesquiphellandrene | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2554167 | Reaxys |
| CAS:20307-83-9 | KEGG COMPOUND |
| CAS:20307-83-9 | ChemIDplus |
| Citations |
|---|