EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H16ClN3O3S |
| Net Charge | 0 |
| Average Mass | 365.842 |
| Monoisotopic Mass | 365.06009 |
| SMILES | Cc1ccccc1N1C(=O)c2cc(S(N)(=O)=O)c(Cl)cc2NC1C |
| InChI | InChI=1S/C16H16ClN3O3S/c1-9-5-3-4-6-14(9)20-10(2)19-13-8-12(17)15(24(18,22)23)7-11(13)16(20)21/h3-8,10,19H,1-2H3,(H2,18,22,23) |
| InChIKey | AQCHWTWZEMGIFD-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | ion transport inhibitor A compound which inhibits the movement of an ion across an energy-transducing cell membrane. |
| Applications: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. diuretic An agent that promotes the excretion of urine through its effects on kidney function. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| metolazone (CHEBI:64354) has role antihypertensive agent (CHEBI:35674) |
| metolazone (CHEBI:64354) has role cardiovascular drug (CHEBI:35554) |
| metolazone (CHEBI:64354) has role diuretic (CHEBI:35498) |
| metolazone (CHEBI:64354) has role ion transport inhibitor (CHEBI:50184) |
| metolazone (CHEBI:64354) is a organochlorine compound (CHEBI:36683) |
| metolazone (CHEBI:64354) is a quinazolines (CHEBI:38530) |
| metolazone (CHEBI:64354) is a sulfonamide (CHEBI:35358) |
| IUPAC Name |
|---|
| 7-chloro-2-methyl-3-(2-methylphenyl)-4-oxo-1,2,3,4-tetrahydroquinazoline-6-sulfonamide |
| INNs | Source |
|---|---|
| metolazona | DrugBank |
| metolazone | KEGG DRUG |
| metolazonum | DrugBank |
| Synonyms | Source |
|---|---|
| 2-Methyl-3-o-tolyl-6-sulfamyl-7-chloro-1,2,3,4-tetrahydro-4-quinazolinone | ChemIDplus |
| 7-Chloro-1,2,3,4-tetrahydro-2-methyl-3-(2-methylphenyl)-4-oxo-6-quinazolinesulfonamide | ChemIDplus |
| 7-Chloro-1,2,3,4-tetrahydro-2-methyl-4-oxo-3-o-tolyl-6-quinazolinesulfonamide | ChemIDplus |
| Metazoline | ChEMBL |
| Normelan | ChEMBL |
| NSC-759581 | ChEMBL |
| Brand Names | Source |
|---|---|
| Diulo | ChEMBL |
| Metenix | ChEMBL |
| Mykrox | ChEMBL |
| Xuret | ChEMBL |
| Zaroxolyn | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| 1783 | DrugCentral |
| D00431 | KEGG DRUG |
| DB00524 | DrugBank |
| LSM-1680 | LINCS |
| Metolazone | Wikipedia |
| US2008139593 | Patent |
| US3360518 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:965506 | Reaxys |
| CAS:17560-51-9 | ChemIDplus |
| CAS:17560-51-9 | NIST Chemistry WebBook |
| Citations |
|---|