EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H16ClN3O3S |
| Net Charge | 0 |
| Average Mass | 365.842 |
| Monoisotopic Mass | 365.06009 |
| SMILES | Cc1ccccc1N1C(=O)c2cc(S(N)(=O)=O)c(Cl)cc2NC1C |
| InChI | InChI=1S/C16H16ClN3O3S/c1-9-5-3-4-6-14(9)20-10(2)19-13-8-12(17)15(24(18,22)23)7-11(13)16(20)21/h3-8,10,19H,1-2H3,(H2,18,22,23) |
| InChIKey | AQCHWTWZEMGIFD-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | ion transport inhibitor A compound which inhibits the movement of an ion across an energy-transducing cell membrane. |
| Applications: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. diuretic An agent that promotes the excretion of urine through its effects on kidney function. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| metolazone (CHEBI:64354) has role antihypertensive agent (CHEBI:35674) |
| metolazone (CHEBI:64354) has role diuretic (CHEBI:35498) |
| metolazone (CHEBI:64354) has role ion transport inhibitor (CHEBI:50184) |
| metolazone (CHEBI:64354) is a organochlorine compound (CHEBI:36683) |
| metolazone (CHEBI:64354) is a quinazolines (CHEBI:38530) |
| metolazone (CHEBI:64354) is a sulfonamide (CHEBI:35358) |
| IUPAC Name |
|---|
| 7-chloro-2-methyl-3-(2-methylphenyl)-4-oxo-1,2,3,4-tetrahydroquinazoline-6-sulfonamide |
| INNs | Source |
|---|---|
| metolazone | KEGG DRUG |
| metolazona | DrugBank |
| metolazonum | DrugBank |
| Synonyms | Source |
|---|---|
| 2-Methyl-3-o-tolyl-6-sulfamyl-7-chloro-1,2,3,4-tetrahydro-4-quinazolinone | ChemIDplus |
| 7-Chloro-1,2,3,4-tetrahydro-2-methyl-3-(2-methylphenyl)-4-oxo-6-quinazolinesulfonamide | ChemIDplus |
| 7-Chloro-1,2,3,4-tetrahydro-2-methyl-4-oxo-3-o-tolyl-6-quinazolinesulfonamide | ChemIDplus |
| Brand Name | Source |
|---|---|
| Zaroxolyn | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| D00431 | KEGG DRUG |
| DB00524 | DrugBank |
| US2008139593 | Patent |
| Metolazone | Wikipedia |
| US3360518 | Patent |
| LSM-1680 | LINCS |
| 1783 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:965506 | Reaxys |
| CAS:17560-51-9 | ChemIDplus |
| CAS:17560-51-9 | NIST Chemistry WebBook |
| Citations |
|---|