EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H16N2O2 |
| Net Charge | 0 |
| Average Mass | 160.217 |
| Monoisotopic Mass | 160.12118 |
| SMILES | CNCCCCC(N)C(=O)O |
| InChI | InChI=1S/C7H16N2O2/c1-9-5-3-2-4-6(8)7(10)11/h6,9H,2-5,8H2,1H3,(H,10,11) |
| InChIKey | PQNASZJZHFPQLE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N6-methyllysine (CHEBI:64349) is a lysine derivative (CHEBI:53079) |
| N6-methyllysine (CHEBI:64349) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| IUPAC Name |
|---|
| N6-methyllysine |
| Synonyms | Source |
|---|---|
| N-methyllysine | ChEBI |
| Nε-methyllysine | ChEBI |
| MeLys | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1705267 | Reaxys |