EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H12N2S.HCl |
| Net Charge | 0 |
| Average Mass | 240.759 |
| Monoisotopic Mass | 240.04880 |
| SMILES | Cl.c1ccc([C@H]2CN3CCSC3=N2)cc1 |
| InChI | InChI=1S/C11H12N2S.ClH/c1-2-4-9(5-3-1)10-8-13-6-7-14-11(13)12-10;/h1-5,10H,6-8H2;1H/t10-;/m1./s1 |
| InChIKey | LAZPBGZRMVRFKY-HNCPQSOCSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Levamisole hydrochloride (CHEBI:6433) has role antineoplastic agent (CHEBI:35610) |
| Levamisole hydrochloride (CHEBI:6433) is a organic molecular entity (CHEBI:50860) |
| Synonyms | Source |
|---|---|
| Ascaridil | ChEMBL |
| Ergamisol | KEGG COMPOUND |
| Levamisole hydrochloride | KEGG COMPOUND |
| Levamisoli hydrochloridum | ChEMBL |
| L-narpenol | ChEMBL |
| NSC-177023 | ChEMBL |
| Brand Name | Source |
|---|---|
| Solaskil | ChEMBL |
| Citations |
|---|