EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H21N.HCl |
| Net Charge | 0 |
| Average Mass | 215.768 |
| Monoisotopic Mass | 215.14408 |
| SMILES | CC12CC3CC(C)(C1)CC(N)(C3)C2.Cl |
| InChI | InChI=1S/C12H21N.ClH/c1-10-3-9-4-11(2,6-10)8-12(13,5-9)7-10;/h9H,3-8,13H2,1-2H3;1H |
| InChIKey | LDDHMLJTFXJGPI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | NMDA receptor antagonist Any substance that inhibits the action of N-methyl-D-aspartate (NMDA) receptors. They tend to induce a state known as dissociative anesthesia, marked by catalepsy, amnesia, and analgesia, while side effects can include hallucinations, nightmares, and confusion. Due to their psychotomimetic effects, many NMDA receptor antagonists are used as recreational drugs. dopaminergic agent A drug used for its effects on dopamine receptors, on the life cycle of dopamine, or on the survival of dopaminergic neurons. |
| Applications: | dopaminergic agent A drug used for its effects on dopamine receptors, on the life cycle of dopamine, or on the survival of dopaminergic neurons. antiparkinson drug A drug used in the treatment of Parkinson's disease. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| memantine hydrochloride (CHEBI:64323) has part memantinium(1+) (CHEBI:64325) |
| memantine hydrochloride (CHEBI:64323) has role antidepressant (CHEBI:35469) |
| memantine hydrochloride (CHEBI:64323) has role antiparkinson drug (CHEBI:48407) |
| memantine hydrochloride (CHEBI:64323) has role dopaminergic agent (CHEBI:48560) |
| memantine hydrochloride (CHEBI:64323) has role neuroprotective agent (CHEBI:63726) |
| memantine hydrochloride (CHEBI:64323) has role NMDA receptor antagonist (CHEBI:60643) |
| memantine hydrochloride (CHEBI:64323) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 3,5-dimethyladamantan-1-amine hydrochloride |
| Synonyms | Source |
|---|---|
| 1-Amino-3,5-dimethyladamantane hydrochloride | ChemIDplus |
| 3,5-Dimethyl-1-adamantanamine hydrochloride | ChemIDplus |
| 3,5-dimethyladamantan-1-aminium chloride | IUPAC |
| 3,5-dimethyltricyclo(3.3.1.13,7)decan-1-amine hydrochloride | ChemIDplus |
| memantine.HCl | ChEBI |
| Memantine HCl | ChemIDplus |
| Brand Name | Source |
|---|---|
| Namenda | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D04905 | KEGG DRUG |
| DB01043 | DrugBank |
| US2011282100 | Patent |
| WO2011125062 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6573843 | Reaxys |
| CAS:41100-52-1 | ChemIDplus |
| CAS:41100-52-1 | KEGG DRUG |
| Citations |
|---|