EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H22F7N4O6P |
| Net Charge | 0 |
| Average Mass | 614.411 |
| Monoisotopic Mass | 614.11652 |
| SMILES | C[C@@H](O[C@H]1OCCN(Cc2nc(=O)n(P(=O)(O)O)n2)[C@H]1c1ccc(F)cc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H22F7N4O6P/c1-12(14-8-15(22(25,26)27)10-16(9-14)23(28,29)30)40-20-19(13-2-4-17(24)5-3-13)33(6-7-39-20)11-18-31-21(35)34(32-18)41(36,37)38/h2-5,8-10,12,19-20H,6-7,11H2,1H3,(H,31,32,35)(H2,36,37,38)/t12-,19+,20-/m1/s1 |
| InChIKey | BARDROPHSZEBKC-OITMNORJSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | neurokinin-1 receptor antagonist An antagonist at the neurokinin-1 receptor. |
| Applications: | antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fosaprepitant (CHEBI:64321) has role antiemetic (CHEBI:50919) |
| fosaprepitant (CHEBI:64321) has role antineoplastic agent (CHEBI:35610) |
| fosaprepitant (CHEBI:64321) has role neurokinin-1 receptor antagonist (CHEBI:55350) |
| fosaprepitant (CHEBI:64321) has role neuroprotective agent (CHEBI:63726) |
| fosaprepitant (CHEBI:64321) has role prodrug (CHEBI:50266) |
| fosaprepitant (CHEBI:64321) is a (trifluoromethyl)benzenes (CHEBI:83565) |
| fosaprepitant (CHEBI:64321) is a cyclic acetal (CHEBI:59770) |
| fosaprepitant (CHEBI:64321) is a morpholines (CHEBI:38785) |
| fosaprepitant (CHEBI:64321) is a organic molecular entity (CHEBI:50860) |
| fosaprepitant (CHEBI:64321) is a phosphoramide (CHEBI:17102) |
| fosaprepitant (CHEBI:64321) is a triazoles (CHEBI:35727) |
| fosaprepitant (CHEBI:64321) is conjugate acid of fosaprepitant(2−) (CHEBI:64322) |
| Incoming Relation(s) |
| fosaprepitant(2−) (CHEBI:64322) is conjugate base of fosaprepitant (CHEBI:64321) |
| IUPAC Name |
|---|
| (3-{[(2R,3S)-2-{(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy}-3-(4-fluorophenyl)morpholin-4-yl]methyl}-5-oxo-4,5-dihydro-1H-1,2,4-triazol-1-yl)phosphonic acid |
| INNs | Source |
|---|---|
| fosaprepitant | WHO MedNet |
| fosaprepitant | ChemIDplus |
| fosaprépitant | WHO MedNet |
| fosaprepitantum | WHO MedNet |
| Synonyms | Source |
|---|---|
| L-758,298 | ChemIDplus |
| L-758298 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 4470 | DrugCentral |
| DB06717 | DrugBank |
| Fosaprepitant_dimeglumine | Wikipedia |
| HMDB0015662 | HMDB |
| US2010029592 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8601672 | Reaxys |
| CAS:172673-20-0 | ChemIDplus |
| Citations |
|---|