EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H22F7N4O6P |
| Net Charge | 0 |
| Average Mass | 614.411 |
| Monoisotopic Mass | 614.11652 |
| SMILES | C[C@@H](O[C@H]1OCCN(Cc2nc(=O)n(P(=O)(O)O)n2)[C@H]1c1ccc(F)cc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H22F7N4O6P/c1-12(14-8-15(22(25,26)27)10-16(9-14)23(28,29)30)40-20-19(13-2-4-17(24)5-3-13)33(6-7-39-20)11-18-31-21(35)34(32-18)41(36,37)38/h2-5,8-10,12,19-20H,6-7,11H2,1H3,(H,31,32,35)(H2,36,37,38)/t12-,19+,20-/m1/s1 |
| InChIKey | BARDROPHSZEBKC-OITMNORJSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | neurokinin-1 receptor antagonist An antagonist at the neurokinin-1 receptor. |
| Applications: | prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fosaprepitant (CHEBI:64321) has role antiemetic (CHEBI:50919) |
| fosaprepitant (CHEBI:64321) has role antineoplastic agent (CHEBI:35610) |
| fosaprepitant (CHEBI:64321) has role neurokinin-1 receptor antagonist (CHEBI:55350) |
| fosaprepitant (CHEBI:64321) has role neuroprotective agent (CHEBI:63726) |
| fosaprepitant (CHEBI:64321) has role prodrug (CHEBI:50266) |
| fosaprepitant (CHEBI:64321) is a (trifluoromethyl)benzenes (CHEBI:83565) |
| fosaprepitant (CHEBI:64321) is a cyclic acetal (CHEBI:59770) |
| fosaprepitant (CHEBI:64321) is a morpholines (CHEBI:38785) |
| fosaprepitant (CHEBI:64321) is a phosphoramide (CHEBI:17102) |
| fosaprepitant (CHEBI:64321) is a triazoles (CHEBI:35727) |
| fosaprepitant (CHEBI:64321) is conjugate acid of fosaprepitant(2−) (CHEBI:64322) |
| Incoming Relation(s) |
| fosaprepitant(2−) (CHEBI:64322) is conjugate base of fosaprepitant (CHEBI:64321) |
| IUPAC Name |
|---|
| (3-{[(2R,3S)-2-{(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy}-3-(4-fluorophenyl)morpholin-4-yl]methyl}-5-oxo-4,5-dihydro-1H-1,2,4-triazol-1-yl)phosphonic acid |
| INNs | Source |
|---|---|
| fosaprepitant | WHO MedNet |
| fosaprepitant | ChemIDplus |
| fosaprépitant | WHO MedNet |
| fosaprepitantum | WHO MedNet |
| Synonyms | Source |
|---|---|
| L-758,298 | ChemIDplus |
| L-758298 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 4470 | DrugCentral |
| DB06717 | DrugBank |
| Fosaprepitant_dimeglumine | Wikipedia |
| HMDB0015662 | HMDB |
| US2010029592 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8601672 | Reaxys |
| CAS:172673-20-0 | ChemIDplus |
| Citations |
|---|