EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:64317 - isoprenaline
| Formula | C11H17NO3 |
| Net Charge | 0 |
| Average Mass | 211.261 |
| Monoisotopic Mass | 211.12084 |
| SMILES | CC(C)NCC(O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C11H17NO3/c1-7(2)12-6-11(15)8-3-4-9(13)10(14)5-8/h3-5,7,11-15H,6H2,1-2H3 |
| InChIKey | JWZZKOKVBUJMES-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | beta-adrenergic agonist An agent that selectively binds to and activates β-adrenergic receptors. sympathomimetic agent A drug that mimics the effects of stimulating postganglionic adrenergic sympathetic nerves. Included in this class are drugs that directly stimulate adrenergic receptors and drugs that act indirectly by provoking the release of adrenergic transmitters. |
| Applications: | bronchodilator agent An agent that causes an increase in the expansion of a bronchus or bronchial tubes. cardiotonic drug A drug that has a strengthening effect on the heart or that can increase cardiac output. beta-adrenergic agonist An agent that selectively binds to and activates β-adrenergic receptors. sympathomimetic agent A drug that mimics the effects of stimulating postganglionic adrenergic sympathetic nerves. Included in this class are drugs that directly stimulate adrenergic receptors and drugs that act indirectly by provoking the release of adrenergic transmitters. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isoprenaline (CHEBI:64317) has role bronchodilator agent (CHEBI:35523) |
| isoprenaline (CHEBI:64317) has role cardiotonic drug (CHEBI:38147) |
| isoprenaline (CHEBI:64317) has role sympathomimetic agent (CHEBI:35524) |
| isoprenaline (CHEBI:64317) has role β-adrenergic agonist (CHEBI:35522) |
| isoprenaline (CHEBI:64317) is a catechols (CHEBI:33566) |
| isoprenaline (CHEBI:64317) is a secondary alcohol (CHEBI:35681) |
| isoprenaline (CHEBI:64317) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| 4-[1-hydroxy-2-(propan-2-ylamino)ethyl]benzene-1,2-diol |
| INNs | Source |
|---|---|
| isoprenaline | KEGG DRUG |
| isoprenalinum | ChemIDplus |
| isoprenalina | ChemIDplus |
| isoprénaline | WHO MedNet |
| Synonyms | Source |
|---|---|
| isoproterenol | ChemIDplus |
| isopropyl noradrenaline | ChemIDplus |
| N-isopropylnorepinephrine | ChemIDplus |
| (±)-isoproterenol | ChemIDplus |
| 1-(3,4-dihydroxyphenyl)-2-(isopropylamino)ethanol | ChemIDplus |
| 3,4-dihydroxy-α-[(isopropylamino)methyl]benzyl alcohol | ChemIDplus |