EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H22F7N4O6P.2C7H17NO5 |
| Net Charge | 0 |
| Average Mass | 1004.841 |
| Monoisotopic Mass | 1004.33786 |
| SMILES | CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.C[C@@H](O[C@H]1OCCN(Cc2nc(=O)n(P(=O)(O)O)n2)[C@H]1c1ccc(F)cc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H22F7N4O6P.2C7H17NO5/c1-12(14-8-15(22(25,26)27)10-16(9-14)23(28,29)30)40-20-19(13-2-4-17(24)5-3-13)33(6-7-39-20)11-18-31-21(35)34(32-18)41(36,37)38;2*1-8-2-4(10)6(12)7(13)5(11)3-9/h2-5,8-10,12,19-20H,6-7,11H2,1H3,(H,31,32,35)(H2,36,37,38);2*4-13H,2-3H2,1H3/t12-,19+,20-;2*4-,5+,6+,7+/m100/s1 |
| InChIKey | VRQHBYGYXDWZDL-OOZCZQCLSA-N |
| Roles Classification |
|---|
| Biological Role: | neurokinin-1 receptor antagonist An antagonist at the neurokinin-1 receptor. |
| Applications: | prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fosaprepitant dimeglumine (CHEBI:64311) has part fosaprepitant(2−) (CHEBI:64322) |
| fosaprepitant dimeglumine (CHEBI:64311) has role antiemetic (CHEBI:50919) |
| fosaprepitant dimeglumine (CHEBI:64311) has role neurokinin-1 receptor antagonist (CHEBI:55350) |
| fosaprepitant dimeglumine (CHEBI:64311) has role prodrug (CHEBI:50266) |
| fosaprepitant dimeglumine (CHEBI:64311) is a organoammonium salt (CHEBI:46850) |
| IUPAC Name |
|---|
| (3-{[(2R,3S)-2-{(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy}-3-(4-fluorophenyl)morpholin-4-yl]methyl}-5-oxo-4,5-dihydro-1H-1,2,4-triazol-1-yl)phosphonic acid—1-deoxy-1-(methylamino)-D-glucitol (1/2) |
| Synonyms | Source |
|---|---|
| bis[1-deoxy-1-(methylazaniumyl)-D-glucitol] (3-{[(2R,3S)-2-{(1R,)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy}-3-(4-fluorophenyl)morpholin-4-yl]methyl}-5-oxo-4,5-dihydro-1H-1,2,4-triazol-1-yl)phosphonate | IUPAC |
| Fosaprepitant meglumine | KEGG DRUG |
| MK-0517 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D06597 | KEGG DRUG |
| EP2303901 | Patent |
| US2011130366 | Patent |
| WO2010018595 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8608007 | Reaxys |
| CAS:265121-04-8 | ChemIDplus |
| CAS:265121-04-8 | KEGG DRUG |
| Citations |
|---|